C21H28ClN3O6S — CID 89101632
6-chloro-N-ethyl-2-hydroxy-N-methoxy-3-[[2-[[(1R)-1-[(5R)-5-methyloxolan-2-yl]propyl]amino]-3,4-dioxocyclobuten-1-yl]amino]benzenesulfinamide (PubChem CID 89101632) has the molecular formula C21H28ClN3O6S and a molecular weight of 485.99 g/mol. Its IUPAC name is 6-chloro-N-ethyl-2-hydroxy-N-methoxy-3-[[2-[[(1R)-1-[(5R)-5-methyloxolan-2-yl]propyl]amino]-3,4-dioxocyclobuten-1-yl]amino]benzenesulfinamide.
| Compound Name | 6-chloro-N-ethyl-2-hydroxy-N-methoxy-3-[[2-[[(1R)-1-[(5R)-5-methyloxolan-2-yl]propyl]amino]-3,4-dioxocyclobuten-1-yl]amino]benzenesulfinamide |
|---|---|
| PubChem CID | 89101632 |
| Molecular Formula | C21H28ClN3O6S |
| Molecular Weight | 485.99 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | 6-chloro-N-ethyl-2-hydroxy-N-methoxy-3-[[2-[[(1R)-1-[(5R)-5-methyloxolan-2-yl]propyl]amino]-3,4-dioxocyclobuten-1-yl]amino]benzenesulfinamide |
| SMILES | CC[C@@H](Nc1c(Nc2ccc(Cl)c(S(=O)N(CC)OC)c2O)c(=O)c1=O)C1CC[C@@H](C)O1 |
| InChI | InChI=1S/C21H28ClN3O6S/c1-5-13(15-10-7-11(3)31-15)23-16-17(20(28)19(16)27)24-14-9-8-12(22)21(18(14)26)32(29)25(6-2)30-4/h8-9,11,13,15,23-24,26H,5-7,10H2,1-4H3/t11-,13-,15?,32?/m1/s1 |
| InChIKey | IVQBJOXVQFZQLP-YBWMCDJKSA-N |
| XLogP | 3.05 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.99 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|