About (N'-methylcarbamimidoyl) methanimidothioate
(N'-methylcarbamimidoyl) methanimidothioate (PubChem CID 89101765) has the molecular formula C3H7N3S
and a molecular weight of 117.18 g/mol. Its IUPAC name is (N'-methylcarbamimidoyl) methanimidothioate.
Molecular Properties
| Compound Name | (N'-methylcarbamimidoyl) methanimidothioate |
| PubChem CID | 89101765 |
| Molecular Formula | C3H7N3S |
| Molecular Weight | 117.18 g/mol |
| Exact Mass | 117.04 |
| IUPAC Name | (N'-methylcarbamimidoyl) methanimidothioate |
| SMILES | [H]/N=C/S/C(N)=N/C |
| InChI | InChI=1S/C3H7N3S/c1-6-3(5)7-2-4/h2,4H,1H3,(H2,5,6)/b4-2+ |
| InChIKey | GWQXLUFMNRMVAJ-DUXPYHPUSA-N |
| XLogP | 0.27 |
| TPSA | 62.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.18 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (N'-methylcarbamimidoyl) methanimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (N'-methylcarbamimidoyl) methanimidothioate?
The IUPAC name of (N'-methylcarbamimidoyl) methanimidothioate (CID 89101765) is (N'-methylcarbamimidoyl) methanimidothioate.
What is the SMILES notation for (N'-methylcarbamimidoyl) methanimidothioate?
The canonical SMILES for (N'-methylcarbamimidoyl) methanimidothioate is [H]/N=C/S/C(N)=N/C.
What is the InChIKey of (N'-methylcarbamimidoyl) methanimidothioate?
The InChIKey is GWQXLUFMNRMVAJ-DUXPYHPUSA-N. The full InChI is InChI=1S/C3H7N3S/c1-6-3(5)7-2-4/h2,4H,1H3,(H2,5,6)/b4-2+.
What are the key properties of (N'-methylcarbamimidoyl) methanimidothioate?
(N'-methylcarbamimidoyl) methanimidothioate has a molecular weight of 117.18 g/mol, XLogP of 0.27, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (N'-methylcarbamimidoyl) methanimidothioate is sourced from PubChem (CID 89101765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).