C9H11NO — CID 89101945
(3E,5Z)-7-hydroxy-3-methylocta-3,5,7-trienenitrile (PubChem CID 89101945) has the molecular formula C9H11NO and a molecular weight of 149.19 g/mol. Its IUPAC name is (3E,5Z)-7-hydroxy-3-methylocta-3,5,7-trienenitrile.
| Compound Name | (3E,5Z)-7-hydroxy-3-methylocta-3,5,7-trienenitrile |
|---|---|
| PubChem CID | 89101945 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | (3E,5Z)-7-hydroxy-3-methylocta-3,5,7-trienenitrile |
| SMILES | C=C(O)/C=C\C=C(/C)CC#N |
| InChI | InChI=1S/C9H11NO/c1-8(6-7-10)4-3-5-9(2)11/h3-5,11H,2,6H2,1H3/b5-3-,8-4+ |
| InChIKey | ULUNMKZMYDUUID-VOGDQUTBSA-N |
| XLogP | 2.47 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|