About 1-benzothiophene-2,5-diamine
1-benzothiophene-2,5-diamine (PubChem CID 89101949) has the molecular formula C8H8N2S
and a molecular weight of 164.23 g/mol. Its IUPAC name is 1-benzothiophene-2,5-diamine.
Molecular Properties
| Compound Name | 1-benzothiophene-2,5-diamine |
| PubChem CID | 89101949 |
| Molecular Formula | C8H8N2S |
| Molecular Weight | 164.23 g/mol |
| Exact Mass | 164.04 |
| IUPAC Name | 1-benzothiophene-2,5-diamine |
| SMILES | Nc1ccc2sc(N)cc2c1 |
| InChI | InChI=1S/C8H8N2S/c9-6-1-2-7-5(3-6)4-8(10)11-7/h1-4H,9-10H2 |
| InChIKey | WUQRXWQNYPQPIB-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.23 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-benzothiophene-2,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzothiophene-2,5-diamine?
The IUPAC name of 1-benzothiophene-2,5-diamine (CID 89101949) is 1-benzothiophene-2,5-diamine.
What is the SMILES notation for 1-benzothiophene-2,5-diamine?
The canonical SMILES for 1-benzothiophene-2,5-diamine is Nc1ccc2sc(N)cc2c1.
What is the InChIKey of 1-benzothiophene-2,5-diamine?
The InChIKey is WUQRXWQNYPQPIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2S/c9-6-1-2-7-5(3-6)4-8(10)11-7/h1-4H,9-10H2.
What are the key properties of 1-benzothiophene-2,5-diamine?
1-benzothiophene-2,5-diamine has a molecular weight of 164.23 g/mol, XLogP of 2.07, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzothiophene-2,5-diamine is sourced from PubChem (CID 89101949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).