C7H8N4 — CID 89101960
N-methylpyrrolo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 89101960) has the molecular formula C7H8N4 and a molecular weight of 148.17 g/mol. Its IUPAC name is N-methylpyrrolo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | N-methylpyrrolo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 89101960 |
| Molecular Formula | C7H8N4 |
| Molecular Weight | 148.17 g/mol |
| Exact Mass | 148.07 |
| IUPAC Name | N-methylpyrrolo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | CNc1ncnn2cccc12 |
| InChI | InChI=1S/C7H8N4/c1-8-7-6-3-2-4-11(6)10-5-9-7/h2-5H,1H3,(H,8,9,10) |
| InChIKey | ATFRCSUHHNRRLZ-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.17 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |