C21H23F3N2O6S2 — CID 89102010
[(2S,3S)-5-[2-(dimethylamino)ethyl]-3-hydroxy-2-(4-methoxyphenyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-9-yl] trifluoromethanesulfonate (PubChem CID 89102010) has the molecular formula C21H23F3N2O6S2 and a molecular weight of 520.55 g/mol. Its IUPAC name is [(2S,3S)-5-[2-(dimethylamino)ethyl]-3-hydroxy-2-(4-methoxyphenyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-9-yl] trifluoromethanesulfonate.
| Compound Name | [(2S,3S)-5-[2-(dimethylamino)ethyl]-3-hydroxy-2-(4-methoxyphenyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-9-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 89102010 |
| Molecular Formula | C21H23F3N2O6S2 |
| Molecular Weight | 520.55 g/mol |
| Exact Mass | 520.09 |
| IUPAC Name | [(2S,3S)-5-[2-(dimethylamino)ethyl]-3-hydroxy-2-(4-methoxyphenyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-9-yl] trifluoromethanesulfonate |
| SMILES | COc1ccc([C@@H]2Sc3c(OS(=O)(=O)C(F)(F)F)cccc3N(CCN(C)C)C(=O)[C@@H]2O)cc1 |
| InChI | InChI=1S/C21H23F3N2O6S2/c1-25(2)11-12-26-15-5-4-6-16(32-34(29,30)21(22,23)24)19(15)33-18(17(27)20(26)28)13-7-9-14(31-3)10-8-13/h4-10,17-18,27H,11-12H2,1-3H3/t17-,18+/m1/s1 |
| InChIKey | FRCIQXNNXMCPPB-MSOLQXFVSA-N |
| XLogP | 3.03 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.55 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|