C25H47NO7 — CID 89102258
(2S,3S)-N-[(S)-[(2S,4R,6R)-6-[(2R)-2-butoxybutyl]-4-hydroxy-5,5-dimethyloxan-2-yl]-methoxymethyl]-2-hydroxy-3-methoxy-5-methylhex-5-enamide (PubChem CID 89102258) has the molecular formula C25H47NO7 and a molecular weight of 473.65 g/mol. Its IUPAC name is (2S,3S)-N-[(S)-[(2S,4R,6R)-6-[(2R)-2-butoxybutyl]-4-hydroxy-5,5-dimethyloxan-2-yl]-methoxymethyl]-2-hydroxy-3-methoxy-5-methylhex-5-enamide.
| Compound Name | (2S,3S)-N-[(S)-[(2S,4R,6R)-6-[(2R)-2-butoxybutyl]-4-hydroxy-5,5-dimethyloxan-2-yl]-methoxymethyl]-2-hydroxy-3-methoxy-5-methylhex-5-enamide |
|---|---|
| PubChem CID | 89102258 |
| Molecular Formula | C25H47NO7 |
| Molecular Weight | 473.65 g/mol |
| Exact Mass | 473.34 |
| IUPAC Name | (2S,3S)-N-[(S)-[(2S,4R,6R)-6-[(2R)-2-butoxybutyl]-4-hydroxy-5,5-dimethyloxan-2-yl]-methoxymethyl]-2-hydroxy-3-methoxy-5-methylhex-5-enamide |
| SMILES | C=C(C)C[C@H](OC)[C@H](O)C(=O)N[C@@H](OC)[C@@H]1C[C@@H](O)C(C)(C)[C@@H](C[C@@H](CC)OCCCC)O1 |
| InChI | InChI=1S/C25H47NO7/c1-9-11-12-32-17(10-2)14-21-25(5,6)20(27)15-19(33-21)24(31-8)26-23(29)22(28)18(30-7)13-16(3)4/h17-22,24,27-28H,3,9-15H2,1-2,4-8H3,(H,26,29)/t17-,18+,19+,20-,21-,22+,24+/m1/s1 |
| InChIKey | XVRKMYVBDZRVAQ-LUEZMJHUSA-N |
| XLogP | 2.95 |
| TPSA | 106.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.65 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|