C7H13NO4 — CID 89102266
(1S,2S,6R,7R)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1,2,6,7-tetrol (PubChem CID 89102266) has the molecular formula C7H13NO4 and a molecular weight of 175.18 g/mol. Its IUPAC name is (1S,2S,6R,7R)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1,2,6,7-tetrol.
| Compound Name | (1S,2S,6R,7R)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1,2,6,7-tetrol |
|---|---|
| PubChem CID | 89102266 |
| Molecular Formula | C7H13NO4 |
| Molecular Weight | 175.18 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | (1S,2S,6R,7R)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1,2,6,7-tetrol |
| SMILES | O[C@@H]1CN2C[C@H](O)[C@@H](O)C2[C@H]1O |
| InChI | InChI=1S/C7H13NO4/c9-3-1-8-2-4(10)7(12)5(8)6(3)11/h3-7,9-12H,1-2H2/t3-,4+,5?,6+,7- |
| InChIKey | CXWWINPFWYPLRL-XPIIGSSCSA-N |
| XLogP | -2.87 |
| TPSA | 84.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.18 |
| LogP ≤ 5 | -2.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |