C11H9ClN4O — CID 89102641
2-chloro-5-methyl-N-(3-nitrosophenyl)pyrimidin-4-amine (PubChem CID 89102641) has the molecular formula C11H9ClN4O and a molecular weight of 248.67 g/mol. Its IUPAC name is 2-chloro-5-methyl-N-(3-nitrosophenyl)pyrimidin-4-amine.
| Compound Name | 2-chloro-5-methyl-N-(3-nitrosophenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 89102641 |
| Molecular Formula | C11H9ClN4O |
| Molecular Weight | 248.67 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | 2-chloro-5-methyl-N-(3-nitrosophenyl)pyrimidin-4-amine |
| SMILES | Cc1cnc(Cl)nc1Nc1cccc(N=O)c1 |
| InChI | InChI=1S/C11H9ClN4O/c1-7-6-13-11(12)15-10(7)14-8-3-2-4-9(5-8)16-17/h2-6H,1H3,(H,13,14,15) |
| InChIKey | BARZGZFGYCPLPM-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 67.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.67 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |