C23H31ClN4O — CID 89103016
5-chloro-N-[2-(cyclohexen-1-yl)-4-[(2S,6R)-2,6-dimethylpiperidin-4-yl]phenyl]-4,5-dihydro-1H-imidazole-2-carboxamide (PubChem CID 89103016) has the molecular formula C23H31ClN4O and a molecular weight of 414.98 g/mol. Its IUPAC name is 5-chloro-N-[2-(cyclohexen-1-yl)-4-[(2S,6R)-2,6-dimethylpiperidin-4-yl]phenyl]-4,5-dihydro-1H-imidazole-2-carboxamide.
| Compound Name | 5-chloro-N-[2-(cyclohexen-1-yl)-4-[(2S,6R)-2,6-dimethylpiperidin-4-yl]phenyl]-4,5-dihydro-1H-imidazole-2-carboxamide |
|---|---|
| PubChem CID | 89103016 |
| Molecular Formula | C23H31ClN4O |
| Molecular Weight | 414.98 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | 5-chloro-N-[2-(cyclohexen-1-yl)-4-[(2S,6R)-2,6-dimethylpiperidin-4-yl]phenyl]-4,5-dihydro-1H-imidazole-2-carboxamide |
| SMILES | C[C@@H]1CC(c2ccc(NC(=O)C3=NCC(Cl)N3)c(C3=CCCCC3)c2)C[C@H](C)N1 |
| InChI | InChI=1S/C23H31ClN4O/c1-14-10-18(11-15(2)26-14)17-8-9-20(19(12-17)16-6-4-3-5-7-16)27-23(29)22-25-13-21(24)28-22/h6,8-9,12,14-15,18,21,26H,3-5,7,10-11,13H2,1-2H3,(H,25,28)(H,27,29)/t14-,15+,18?,21? |
| InChIKey | BFCQTERTSGPAHN-CHLRHJHGSA-N |
| XLogP | 4.39 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.98 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|