About 2-(cyclopropylmethoxy)-N,3,3-trimethylbutanamide
2-(cyclopropylmethoxy)-N,3,3-trimethylbutanamide (PubChem CID 89103091) has the molecular formula C11H21NO2
and a molecular weight of 199.29 g/mol. Its IUPAC name is 2-(cyclopropylmethoxy)-N,3,3-trimethylbutanamide.
Molecular Properties
| Compound Name | 2-(cyclopropylmethoxy)-N,3,3-trimethylbutanamide |
| PubChem CID | 89103091 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | 2-(cyclopropylmethoxy)-N,3,3-trimethylbutanamide |
| SMILES | CNC(=O)C(OCC1CC1)C(C)(C)C |
| InChI | InChI=1S/C11H21NO2/c1-11(2,3)9(10(13)12-4)14-7-8-5-6-8/h8-9H,5-7H2,1-4H3,(H,12,13) |
| InChIKey | UBNITKKDLLPKLS-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(cyclopropylmethoxy)-N,3,3-trimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(cyclopropylmethoxy)-N,3,3-trimethylbutanamide?
The IUPAC name of 2-(cyclopropylmethoxy)-N,3,3-trimethylbutanamide (CID 89103091) is 2-(cyclopropylmethoxy)-N,3,3-trimethylbutanamide.
What is the SMILES notation for 2-(cyclopropylmethoxy)-N,3,3-trimethylbutanamide?
The canonical SMILES for 2-(cyclopropylmethoxy)-N,3,3-trimethylbutanamide is CNC(=O)C(OCC1CC1)C(C)(C)C.
What is the InChIKey of 2-(cyclopropylmethoxy)-N,3,3-trimethylbutanamide?
The InChIKey is UBNITKKDLLPKLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO2/c1-11(2,3)9(10(13)12-4)14-7-8-5-6-8/h8-9H,5-7H2,1-4H3,(H,12,13).
What are the key properties of 2-(cyclopropylmethoxy)-N,3,3-trimethylbutanamide?
2-(cyclopropylmethoxy)-N,3,3-trimethylbutanamide has a molecular weight of 199.29 g/mol, XLogP of 1.57, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyclopropylmethoxy)-N,3,3-trimethylbutanamide is sourced from PubChem (CID 89103091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).