C27H52O4Si2 — CID 89103289
ethyl (2E,4E,6E,8S,9S)-9,11-bis[[tert-butyl(dimethyl)silyl]oxy]-6,8-dimethylundeca-2,4,6-trienoate (PubChem CID 89103289) has the molecular formula C27H52O4Si2 and a molecular weight of 496.88 g/mol. Its IUPAC name is ethyl (2E,4E,6E,8S,9S)-9,11-bis[[tert-butyl(dimethyl)silyl]oxy]-6,8-dimethylundeca-2,4,6-trienoate.
| Compound Name | ethyl (2E,4E,6E,8S,9S)-9,11-bis[[tert-butyl(dimethyl)silyl]oxy]-6,8-dimethylundeca-2,4,6-trienoate |
|---|---|
| PubChem CID | 89103289 |
| Molecular Formula | C27H52O4Si2 |
| Molecular Weight | 496.88 g/mol |
| Exact Mass | 496.34 |
| IUPAC Name | ethyl (2E,4E,6E,8S,9S)-9,11-bis[[tert-butyl(dimethyl)silyl]oxy]-6,8-dimethylundeca-2,4,6-trienoate |
| SMILES | CCOC(=O)/C=C/C=C/C(C)=C/[C@H](C)[C@H](CCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H52O4Si2/c1-14-29-25(28)18-16-15-17-22(2)21-23(3)24(31-33(12,13)27(7,8)9)19-20-30-32(10,11)26(4,5)6/h15-18,21,23-24H,14,19-20H2,1-13H3/b17-15+,18-16+,22-21+/t23-,24-/m0/s1 |
| InChIKey | OLGVFSKLGXISCF-HRNIXIKFSA-N |
| XLogP | 8.05 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.88 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|