About 1-ethenoxy-1,4-dimethylcyclohexane
1-ethenoxy-1,4-dimethylcyclohexane (PubChem CID 89103866) has the molecular formula C10H18O
and a molecular weight of 154.25 g/mol. Its IUPAC name is 1-ethenoxy-1,4-dimethylcyclohexane.
Molecular Properties
| Compound Name | 1-ethenoxy-1,4-dimethylcyclohexane |
| PubChem CID | 89103866 |
| Molecular Formula | C10H18O |
| Molecular Weight | 154.25 g/mol |
| Exact Mass | 154.14 |
| IUPAC Name | 1-ethenoxy-1,4-dimethylcyclohexane |
| SMILES | C=COC1(C)CCC(C)CC1 |
| InChI | InChI=1S/C10H18O/c1-4-11-10(3)7-5-9(2)6-8-10/h4,9H,1,5-8H2,2-3H3 |
| InChIKey | LRBHFGLGGANFMX-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.25 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 1-ethenoxy-1,4-dimethylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenoxy-1,4-dimethylcyclohexane?
The IUPAC name of 1-ethenoxy-1,4-dimethylcyclohexane (CID 89103866) is 1-ethenoxy-1,4-dimethylcyclohexane.
What is the SMILES notation for 1-ethenoxy-1,4-dimethylcyclohexane?
The canonical SMILES for 1-ethenoxy-1,4-dimethylcyclohexane is C=COC1(C)CCC(C)CC1.
What is the InChIKey of 1-ethenoxy-1,4-dimethylcyclohexane?
The InChIKey is LRBHFGLGGANFMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O/c1-4-11-10(3)7-5-9(2)6-8-10/h4,9H,1,5-8H2,2-3H3.
What are the key properties of 1-ethenoxy-1,4-dimethylcyclohexane?
1-ethenoxy-1,4-dimethylcyclohexane has a molecular weight of 154.25 g/mol, XLogP of 3.12, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenoxy-1,4-dimethylcyclohexane is sourced from PubChem (CID 89103866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).