C29H16Cl2F2N4O2 — CID 89104101
(3-amino-2,6-difluorophenyl)-[1-(2,6-dichlorobenzoyl)-5-(1H-indol-5-yl)pyrrolo[2,3-b]pyridin-3-yl]methanone (PubChem CID 89104101) has the molecular formula C29H16Cl2F2N4O2 and a molecular weight of 561.38 g/mol. Its IUPAC name is (3-amino-2,6-difluorophenyl)-[1-(2,6-dichlorobenzoyl)-5-(1H-indol-5-yl)pyrrolo[2,3-b]pyridin-3-yl]methanone.
| Compound Name | (3-amino-2,6-difluorophenyl)-[1-(2,6-dichlorobenzoyl)-5-(1H-indol-5-yl)pyrrolo[2,3-b]pyridin-3-yl]methanone |
|---|---|
| PubChem CID | 89104101 |
| Molecular Formula | C29H16Cl2F2N4O2 |
| Molecular Weight | 561.38 g/mol |
| Exact Mass | 560.06 |
| IUPAC Name | (3-amino-2,6-difluorophenyl)-[1-(2,6-dichlorobenzoyl)-5-(1H-indol-5-yl)pyrrolo[2,3-b]pyridin-3-yl]methanone |
| SMILES | Nc1ccc(F)c(C(=O)c2cn(C(=O)c3c(Cl)cccc3Cl)c3ncc(-c4ccc5[nH]ccc5c4)cc23)c1F |
| InChI | InChI=1S/C29H16Cl2F2N4O2/c30-19-2-1-3-20(31)24(19)29(39)37-13-18(27(38)25-21(32)5-6-22(34)26(25)33)17-11-16(12-36-28(17)37)14-4-7-23-15(10-14)8-9-35-23/h1-13,35H,34H2 |
| InChIKey | ULRWYHVWIWJRNZ-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 93.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.38 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|