About 2,5-bis(ethenoxy)heptane
2,5-bis(ethenoxy)heptane (PubChem CID 89104177) has the molecular formula C11H20O2
and a molecular weight of 184.28 g/mol. Its IUPAC name is 2,5-bis(ethenoxy)heptane.
Molecular Properties
| Compound Name | 2,5-bis(ethenoxy)heptane |
| PubChem CID | 89104177 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | 2,5-bis(ethenoxy)heptane |
| SMILES | C=COC(C)CCC(CC)OC=C |
| InChI | InChI=1S/C11H20O2/c1-5-11(13-7-3)9-8-10(4)12-6-2/h6-7,10-11H,2-3,5,8-9H2,1,4H3 |
| InChIKey | SNUCKXKMXKBRBY-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 2,5-bis(ethenoxy)heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-bis(ethenoxy)heptane?
The IUPAC name of 2,5-bis(ethenoxy)heptane (CID 89104177) is 2,5-bis(ethenoxy)heptane.
What is the SMILES notation for 2,5-bis(ethenoxy)heptane?
The canonical SMILES for 2,5-bis(ethenoxy)heptane is C=COC(C)CCC(CC)OC=C.
What is the InChIKey of 2,5-bis(ethenoxy)heptane?
The InChIKey is SNUCKXKMXKBRBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O2/c1-5-11(13-7-3)9-8-10(4)12-6-2/h6-7,10-11H,2-3,5,8-9H2,1,4H3.
What are the key properties of 2,5-bis(ethenoxy)heptane?
2,5-bis(ethenoxy)heptane has a molecular weight of 184.28 g/mol, XLogP of 3.25, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-bis(ethenoxy)heptane is sourced from PubChem (CID 89104177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).