C24H13ClF11N3O3 — CID 89104184
2-chloro-N-[2-fluoro-3-[[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methyl-6-(trifluoromethoxy)phenyl]carbamoyl]phenyl]pyridine-3-carboxamide (PubChem CID 89104184) has the molecular formula C24H13ClF11N3O3 and a molecular weight of 635.82 g/mol. Its IUPAC name is 2-chloro-N-[2-fluoro-3-[[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methyl-6-(trifluoromethoxy)phenyl]carbamoyl]phenyl]pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-[2-fluoro-3-[[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methyl-6-(trifluoromethoxy)phenyl]carbamoyl]phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 89104184 |
| Molecular Formula | C24H13ClF11N3O3 |
| Molecular Weight | 635.82 g/mol |
| Exact Mass | 635.05 |
| IUPAC Name | 2-chloro-N-[2-fluoro-3-[[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methyl-6-(trifluoromethoxy)phenyl]carbamoyl]phenyl]pyridine-3-carboxamide |
| SMILES | Cc1cc(C(F)(C(F)(F)F)C(F)(F)F)cc(OC(F)(F)F)c1NC(=O)c1cccc(NC(=O)c2cccnc2Cl)c1F |
| InChI | InChI=1S/C24H13ClF11N3O3/c1-10-8-11(21(27,22(28,29)30)23(31,32)33)9-15(42-24(34,35)36)17(10)39-19(40)12-4-2-6-14(16(12)26)38-20(41)13-5-3-7-37-18(13)25/h2-9H,1H3,(H,38,41)(H,39,40) |
| InChIKey | LSPJZIZROKAGTQ-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.82 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|