C22H26F3NO3S2 — CID 89104383
2-[2-methyl-4-[(2R)-1-[propyl-[4-(trifluoromethyl)phenyl]sulfanylamino]propan-2-yl]sulfanylphenoxy]acetic acid (PubChem CID 89104383) has the molecular formula C22H26F3NO3S2 and a molecular weight of 473.58 g/mol. Its IUPAC name is 2-[2-methyl-4-[(2R)-1-[propyl-[4-(trifluoromethyl)phenyl]sulfanylamino]propan-2-yl]sulfanylphenoxy]acetic acid.
| Compound Name | 2-[2-methyl-4-[(2R)-1-[propyl-[4-(trifluoromethyl)phenyl]sulfanylamino]propan-2-yl]sulfanylphenoxy]acetic acid |
|---|---|
| PubChem CID | 89104383 |
| Molecular Formula | C22H26F3NO3S2 |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | 2-[2-methyl-4-[(2R)-1-[propyl-[4-(trifluoromethyl)phenyl]sulfanylamino]propan-2-yl]sulfanylphenoxy]acetic acid |
| SMILES | CCCN(C[C@@H](C)Sc1ccc(OCC(=O)O)c(C)c1)Sc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H26F3NO3S2/c1-4-11-26(31-18-7-5-17(6-8-18)22(23,24)25)13-16(3)30-19-9-10-20(15(2)12-19)29-14-21(27)28/h5-10,12,16H,4,11,13-14H2,1-3H3,(H,27,28)/t16-/m1/s1 |
| InChIKey | VJKPMTUBGPPWNJ-MRXNPFEDSA-N |
| XLogP | 6.38 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|