C17H27NO3 — CID 89105125
ethyl (2R,3R)-3-methyl-2-[[(3E,5Z,7Z)-nona-3,5,7-trien-4-yl]amino]-4-oxopentanoate (PubChem CID 89105125) has the molecular formula C17H27NO3 and a molecular weight of 293.41 g/mol. Its IUPAC name is ethyl (2R,3R)-3-methyl-2-[[(3E,5Z,7Z)-nona-3,5,7-trien-4-yl]amino]-4-oxopentanoate.
| Compound Name | ethyl (2R,3R)-3-methyl-2-[[(3E,5Z,7Z)-nona-3,5,7-trien-4-yl]amino]-4-oxopentanoate |
|---|---|
| PubChem CID | 89105125 |
| Molecular Formula | C17H27NO3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | ethyl (2R,3R)-3-methyl-2-[[(3E,5Z,7Z)-nona-3,5,7-trien-4-yl]amino]-4-oxopentanoate |
| SMILES | C/C=C\C=C/C(=C\CC)N[C@@H](C(=O)OCC)[C@@H](C)C(C)=O |
| InChI | InChI=1S/C17H27NO3/c1-6-9-10-12-15(11-7-2)18-16(13(4)14(5)19)17(20)21-8-3/h6,9-13,16,18H,7-8H2,1-5H3/b9-6-,12-10-,15-11+/t13-,16+/m0/s1 |
| InChIKey | AOCYPUIBPIONII-HXAORYASSA-N |
| XLogP | 3.16 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|