C17H26O3 — CID 89105172
methyl 2-[3-methyl-3-[(E)-2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]oxiran-2-yl]acetate (PubChem CID 89105172) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is methyl 2-[3-methyl-3-[(E)-2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]oxiran-2-yl]acetate.
| Compound Name | methyl 2-[3-methyl-3-[(E)-2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]oxiran-2-yl]acetate |
|---|---|
| PubChem CID | 89105172 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | methyl 2-[3-methyl-3-[(E)-2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]oxiran-2-yl]acetate |
| SMILES | COC(=O)CC1OC1(C)/C=C/C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C17H26O3/c1-12-7-6-9-16(2,3)13(12)8-10-17(4)14(20-17)11-15(18)19-5/h8,10,14H,6-7,9,11H2,1-5H3/b10-8+ |
| InChIKey | KZSYDTCPXQWKPV-CSKARUKUSA-N |
| XLogP | 3.79 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|