C15H17N — CID 89105201
(12R)-4-ethyl-9,12-dimethyl-2-azatricyclo[5.4.1.04,12]dodeca-1(11),2,5,7,9-pentaene (PubChem CID 89105201) has the molecular formula C15H17N and a molecular weight of 211.31 g/mol. Its IUPAC name is (12R)-4-ethyl-9,12-dimethyl-2-azatricyclo[5.4.1.04,12]dodeca-1(11),2,5,7,9-pentaene.
| Compound Name | (12R)-4-ethyl-9,12-dimethyl-2-azatricyclo[5.4.1.04,12]dodeca-1(11),2,5,7,9-pentaene |
|---|---|
| PubChem CID | 89105201 |
| Molecular Formula | C15H17N |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | (12R)-4-ethyl-9,12-dimethyl-2-azatricyclo[5.4.1.04,12]dodeca-1(11),2,5,7,9-pentaene |
| SMILES | CCC12C=CC3=CC(C)=CC=C(N=C1)[C@]32C |
| InChI | InChI=1S/C15H17N/c1-4-15-8-7-12-9-11(2)5-6-13(16-10-15)14(12,15)3/h5-10H,4H2,1-3H3/t14-,15?/m0/s1 |
| InChIKey | YFFVNFFMVDHPRP-MLCCFXAWSA-N |
| XLogP | 3.81 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |