C16H27BrO — CID 89105277
(3Z,5E)-5-bromo-3-tert-butyl-2-methoxy-8,8-dimethylnona-1,3,5-triene (PubChem CID 89105277) has the molecular formula C16H27BrO and a molecular weight of 315.30 g/mol. Its IUPAC name is (3Z,5E)-5-bromo-3-tert-butyl-2-methoxy-8,8-dimethylnona-1,3,5-triene.
| Compound Name | (3Z,5E)-5-bromo-3-tert-butyl-2-methoxy-8,8-dimethylnona-1,3,5-triene |
|---|---|
| PubChem CID | 89105277 |
| Molecular Formula | C16H27BrO |
| Molecular Weight | 315.30 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | (3Z,5E)-5-bromo-3-tert-butyl-2-methoxy-8,8-dimethylnona-1,3,5-triene |
| SMILES | C=C(OC)/C(=C\C(Br)=C/CC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C16H27BrO/c1-12(18-8)14(16(5,6)7)11-13(17)9-10-15(2,3)4/h9,11H,1,10H2,2-8H3/b13-9+,14-11+ |
| InChIKey | PIIMNFGTFHJUPT-IJFRVEDASA-N |
| XLogP | 5.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.30 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|