About (3Z)-1,1,1-trifluoro-3-(2-methylpropoxymethylidene)-4-(trifluoromethyl)pent-4-en-2-one
(3Z)-1,1,1-trifluoro-3-(2-methylpropoxymethylidene)-4-(trifluoromethyl)pent-4-en-2-one (PubChem CID 89105402) has the molecular formula C11H12F6O2
and a molecular weight of 290.20 g/mol. Its IUPAC name is (3Z)-1,1,1-trifluoro-3-(2-methylpropoxymethylidene)-4-(trifluoromethyl)pent-4-en-2-one.
Molecular Properties
| Compound Name | (3Z)-1,1,1-trifluoro-3-(2-methylpropoxymethylidene)-4-(trifluoromethyl)pent-4-en-2-one |
| PubChem CID | 89105402 |
| Molecular Formula | C11H12F6O2 |
| Molecular Weight | 290.20 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | (3Z)-1,1,1-trifluoro-3-(2-methylpropoxymethylidene)-4-(trifluoromethyl)pent-4-en-2-one |
| SMILES | C=C(/C(=C/OCC(C)C)C(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H12F6O2/c1-6(2)4-19-5-8(7(3)10(12,13)14)9(18)11(15,16)17/h5-6H,3-4H2,1-2H3/b8-5- |
| InChIKey | DIFVPKHKLWPTRK-YVMONPNESA-N |
| XLogP | 3.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.20 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-1,1,1-trifluoro-3-(2-methylpropoxymethylidene)-4-(trifluoromethyl)pent-4-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-1,1,1-trifluoro-3-(2-methylpropoxymethylidene)-4-(trifluoromethyl)pent-4-en-2-one?
The IUPAC name of (3Z)-1,1,1-trifluoro-3-(2-methylpropoxymethylidene)-4-(trifluoromethyl)pent-4-en-2-one (CID 89105402) is (3Z)-1,1,1-trifluoro-3-(2-methylpropoxymethylidene)-4-(trifluoromethyl)pent-4-en-2-one.
What is the SMILES notation for (3Z)-1,1,1-trifluoro-3-(2-methylpropoxymethylidene)-4-(trifluoromethyl)pent-4-en-2-one?
The canonical SMILES for (3Z)-1,1,1-trifluoro-3-(2-methylpropoxymethylidene)-4-(trifluoromethyl)pent-4-en-2-one is C=C(/C(=C/OCC(C)C)C(=O)C(F)(F)F)C(F)(F)F.
What is the InChIKey of (3Z)-1,1,1-trifluoro-3-(2-methylpropoxymethylidene)-4-(trifluoromethyl)pent-4-en-2-one?
The InChIKey is DIFVPKHKLWPTRK-YVMONPNESA-N. The full InChI is InChI=1S/C11H12F6O2/c1-6(2)4-19-5-8(7(3)10(12,13)14)9(18)11(15,16)17/h5-6H,3-4H2,1-2H3/b8-5-.
What are the key properties of (3Z)-1,1,1-trifluoro-3-(2-methylpropoxymethylidene)-4-(trifluoromethyl)pent-4-en-2-one?
(3Z)-1,1,1-trifluoro-3-(2-methylpropoxymethylidene)-4-(trifluoromethyl)pent-4-en-2-one has a molecular weight of 290.20 g/mol, XLogP of 3.79, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-1,1,1-trifluoro-3-(2-methylpropoxymethylidene)-4-(trifluoromethyl)pent-4-en-2-one is sourced from PubChem (CID 89105402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).