C17H14F3N7 — CID 89105499
3-N-[1-(2-methylindazol-5-yl)-1,2,4-triazol-3-yl]-5-(trifluoromethyl)benzene-1,3-diamine (PubChem CID 89105499) has the molecular formula C17H14F3N7 and a molecular weight of 373.34 g/mol. Its IUPAC name is 3-N-[1-(2-methylindazol-5-yl)-1,2,4-triazol-3-yl]-5-(trifluoromethyl)benzene-1,3-diamine.
| Compound Name | 3-N-[1-(2-methylindazol-5-yl)-1,2,4-triazol-3-yl]-5-(trifluoromethyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 89105499 |
| Molecular Formula | C17H14F3N7 |
| Molecular Weight | 373.34 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 3-N-[1-(2-methylindazol-5-yl)-1,2,4-triazol-3-yl]-5-(trifluoromethyl)benzene-1,3-diamine |
| SMILES | Cn1cc2cc(-n3cnc(Nc4cc(N)cc(C(F)(F)F)c4)n3)ccc2n1 |
| InChI | InChI=1S/C17H14F3N7/c1-26-8-10-4-14(2-3-15(10)24-26)27-9-22-16(25-27)23-13-6-11(17(18,19)20)5-12(21)7-13/h2-9H,21H2,1H3,(H,23,25) |
| InChIKey | SUQJMYAZICKCHP-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 86.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.34 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|