About 2-(3-ethylcyclohexa-1,3-dien-1-yl)pyrimidine
2-(3-ethylcyclohexa-1,3-dien-1-yl)pyrimidine (PubChem CID 89105510) has the molecular formula C12H14N2
and a molecular weight of 186.26 g/mol. Its IUPAC name is 2-(3-ethylcyclohexa-1,3-dien-1-yl)pyrimidine.
Molecular Properties
| Compound Name | 2-(3-ethylcyclohexa-1,3-dien-1-yl)pyrimidine |
| PubChem CID | 89105510 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 2-(3-ethylcyclohexa-1,3-dien-1-yl)pyrimidine |
| SMILES | CCC1=CCCC(c2ncccn2)=C1 |
| InChI | InChI=1S/C12H14N2/c1-2-10-5-3-6-11(9-10)12-13-7-4-8-14-12/h4-5,7-9H,2-3,6H2,1H3 |
| InChIKey | LLSQJRGRCDMOLG-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(3-ethylcyclohexa-1,3-dien-1-yl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-ethylcyclohexa-1,3-dien-1-yl)pyrimidine?
The IUPAC name of 2-(3-ethylcyclohexa-1,3-dien-1-yl)pyrimidine (CID 89105510) is 2-(3-ethylcyclohexa-1,3-dien-1-yl)pyrimidine.
What is the SMILES notation for 2-(3-ethylcyclohexa-1,3-dien-1-yl)pyrimidine?
The canonical SMILES for 2-(3-ethylcyclohexa-1,3-dien-1-yl)pyrimidine is CCC1=CCCC(c2ncccn2)=C1.
What is the InChIKey of 2-(3-ethylcyclohexa-1,3-dien-1-yl)pyrimidine?
The InChIKey is LLSQJRGRCDMOLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2/c1-2-10-5-3-6-11(9-10)12-13-7-4-8-14-12/h4-5,7-9H,2-3,6H2,1H3.
What are the key properties of 2-(3-ethylcyclohexa-1,3-dien-1-yl)pyrimidine?
2-(3-ethylcyclohexa-1,3-dien-1-yl)pyrimidine has a molecular weight of 186.26 g/mol, XLogP of 2.99, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-ethylcyclohexa-1,3-dien-1-yl)pyrimidine is sourced from PubChem (CID 89105510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).