C13H8F4N8O3 — CID 89105592
3-[4-(2-azidoethylamino)-1,2,5-oxadiazol-3-yl]-4-[4-fluoro-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-one (PubChem CID 89105592) has the molecular formula C13H8F4N8O3 and a molecular weight of 400.25 g/mol. Its IUPAC name is 3-[4-(2-azidoethylamino)-1,2,5-oxadiazol-3-yl]-4-[4-fluoro-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-one.
| Compound Name | 3-[4-(2-azidoethylamino)-1,2,5-oxadiazol-3-yl]-4-[4-fluoro-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-one |
|---|---|
| PubChem CID | 89105592 |
| Molecular Formula | C13H8F4N8O3 |
| Molecular Weight | 400.25 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | 3-[4-(2-azidoethylamino)-1,2,5-oxadiazol-3-yl]-4-[4-fluoro-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-one |
| SMILES | [N-]=[N+]=NCCNc1nonc1-c1noc(=O)n1-c1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H8F4N8O3/c14-8-2-1-6(5-7(8)13(15,16)17)25-11(23-27-12(25)26)9-10(22-28-21-9)19-3-4-20-24-18/h1-2,5H,3-4H2,(H,19,22) |
| InChIKey | WRTDGJFDBWKRHB-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 147.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.25 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|