C30H25N5O6 — CID 89105599
phenyl 4-[[4-amino-2-ethoxy-6-[4-(1,3-oxazol-5-yl)anilino]pyridine-3-carbonyl]amino]-2-hydroxybenzoate (PubChem CID 89105599) has the molecular formula C30H25N5O6 and a molecular weight of 551.56 g/mol. Its IUPAC name is phenyl 4-[[4-amino-2-ethoxy-6-[4-(1,3-oxazol-5-yl)anilino]pyridine-3-carbonyl]amino]-2-hydroxybenzoate.
| Compound Name | phenyl 4-[[4-amino-2-ethoxy-6-[4-(1,3-oxazol-5-yl)anilino]pyridine-3-carbonyl]amino]-2-hydroxybenzoate |
|---|---|
| PubChem CID | 89105599 |
| Molecular Formula | C30H25N5O6 |
| Molecular Weight | 551.56 g/mol |
| Exact Mass | 551.18 |
| IUPAC Name | phenyl 4-[[4-amino-2-ethoxy-6-[4-(1,3-oxazol-5-yl)anilino]pyridine-3-carbonyl]amino]-2-hydroxybenzoate |
| SMILES | CCOc1nc(Nc2ccc(-c3cnco3)cc2)cc(N)c1C(=O)Nc1ccc(C(=O)Oc2ccccc2)c(O)c1 |
| InChI | InChI=1S/C30H25N5O6/c1-2-39-29-27(23(31)15-26(35-29)33-19-10-8-18(9-11-19)25-16-32-17-40-25)28(37)34-20-12-13-22(24(36)14-20)30(38)41-21-6-4-3-5-7-21/h3-17,36H,2H2,1H3,(H,34,37)(H3,31,33,35) |
| InChIKey | RIAPWEXMQCTAMB-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 161.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.56 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|