C19H28O5S — CID 89105631
[(2R,3R)-3-methyl-3-[[(2R,3R)-3-[(2R)-pentan-2-yl]oxiran-2-yl]methyl]oxiran-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 89105631) has the molecular formula C19H28O5S and a molecular weight of 368.50 g/mol. Its IUPAC name is [(2R,3R)-3-methyl-3-[[(2R,3R)-3-[(2R)-pentan-2-yl]oxiran-2-yl]methyl]oxiran-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2R,3R)-3-methyl-3-[[(2R,3R)-3-[(2R)-pentan-2-yl]oxiran-2-yl]methyl]oxiran-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 89105631 |
| Molecular Formula | C19H28O5S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | [(2R,3R)-3-methyl-3-[[(2R,3R)-3-[(2R)-pentan-2-yl]oxiran-2-yl]methyl]oxiran-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | CCC[C@@H](C)[C@H]1O[C@@H]1C[C@@]1(C)O[C@@H]1COS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H28O5S/c1-5-6-14(3)18-16(23-18)11-19(4)17(24-19)12-22-25(20,21)15-9-7-13(2)8-10-15/h7-10,14,16-18H,5-6,11-12H2,1-4H3/t14-,16-,17-,18-,19-/m1/s1 |
| InChIKey | JPZHLNULNGBMFX-WSIUPNEHSA-N |
| XLogP | 3.45 |
| TPSA | 68.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|