C8H15BrN2 — CID 89105679
(1Z,3E)-4-bromo-N,N,2-trimethylpenta-1,3-diene-1,5-diamine (PubChem CID 89105679) has the molecular formula C8H15BrN2 and a molecular weight of 219.13 g/mol. Its IUPAC name is (1Z,3E)-4-bromo-N,N,2-trimethylpenta-1,3-diene-1,5-diamine.
| Compound Name | (1Z,3E)-4-bromo-N,N,2-trimethylpenta-1,3-diene-1,5-diamine |
|---|---|
| PubChem CID | 89105679 |
| Molecular Formula | C8H15BrN2 |
| Molecular Weight | 219.13 g/mol |
| Exact Mass | 218.04 |
| IUPAC Name | (1Z,3E)-4-bromo-N,N,2-trimethylpenta-1,3-diene-1,5-diamine |
| SMILES | CC(=C/N(C)C)/C=C(/Br)CN |
| InChI | InChI=1S/C8H15BrN2/c1-7(6-11(2)3)4-8(9)5-10/h4,6H,5,10H2,1-3H3/b7-6-,8-4+ |
| InChIKey | WFKAFHZAMAILPT-AKAREZBESA-N |
| XLogP | 1.69 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.13 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|