C30H29N — CID 89105735
(Z)-3-[(5S)-5-methyl-2,5-bis(4-methylphenyl)cyclohexa-1,3-dien-1-yl]-2-phenylprop-2-en-1-imine (PubChem CID 89105735) has the molecular formula C30H29N and a molecular weight of 403.57 g/mol. Its IUPAC name is (Z)-3-[(5S)-5-methyl-2,5-bis(4-methylphenyl)cyclohexa-1,3-dien-1-yl]-2-phenylprop-2-en-1-imine.
| Compound Name | (Z)-3-[(5S)-5-methyl-2,5-bis(4-methylphenyl)cyclohexa-1,3-dien-1-yl]-2-phenylprop-2-en-1-imine |
|---|---|
| PubChem CID | 89105735 |
| Molecular Formula | C30H29N |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | (Z)-3-[(5S)-5-methyl-2,5-bis(4-methylphenyl)cyclohexa-1,3-dien-1-yl]-2-phenylprop-2-en-1-imine |
| SMILES | [H]/N=C/C(=C\C1=C(c2ccc(C)cc2)C=C[C@@](C)(c2ccc(C)cc2)C1)c1ccccc1 |
| InChI | InChI=1S/C30H29N/c1-22-9-13-25(14-10-22)29-17-18-30(3,28-15-11-23(2)12-16-28)20-26(29)19-27(21-31)24-7-5-4-6-8-24/h4-19,21,31H,20H2,1-3H3/b27-19+,31-21+/t30-/m1/s1 |
| InChIKey | LCAJOTCUSZIFFM-YVBWKKQRSA-N |
| XLogP | 7.71 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|