C17H22O8S — CID 89105780
5-[(5-oxo-5a,6,7,8,9,9a-hexahydro-1H-benzo[e][1,3]dioxepin-7-yl)sulfonyl]-3a,4,5,6,7,7a-hexahydro-2-benzofuran-1,3-dione (PubChem CID 89105780) has the molecular formula C17H22O8S and a molecular weight of 386.42 g/mol. Its IUPAC name is 5-[(5-oxo-5a,6,7,8,9,9a-hexahydro-1H-benzo[e][1,3]dioxepin-7-yl)sulfonyl]-3a,4,5,6,7,7a-hexahydro-2-benzofuran-1,3-dione.
| Compound Name | 5-[(5-oxo-5a,6,7,8,9,9a-hexahydro-1H-benzo[e][1,3]dioxepin-7-yl)sulfonyl]-3a,4,5,6,7,7a-hexahydro-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 89105780 |
| Molecular Formula | C17H22O8S |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 5-[(5-oxo-5a,6,7,8,9,9a-hexahydro-1H-benzo[e][1,3]dioxepin-7-yl)sulfonyl]-3a,4,5,6,7,7a-hexahydro-2-benzofuran-1,3-dione |
| SMILES | O=C1OCOCC2CCC(S(=O)(=O)C3CCC4C(=O)OC(=O)C4C3)CC12 |
| InChI | InChI=1S/C17H22O8S/c18-15-13-5-10(2-1-9(13)7-23-8-24-15)26(21,22)11-3-4-12-14(6-11)17(20)25-16(12)19/h9-14H,1-8H2 |
| InChIKey | NSVYGLIXQSAENL-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|