C9H13N — CID 89105784
(1Z,3Z)-3-ethenyl-N-methylhexa-1,3,5-trien-1-amine (PubChem CID 89105784) has the molecular formula C9H13N and a molecular weight of 135.21 g/mol. Its IUPAC name is (1Z,3Z)-3-ethenyl-N-methylhexa-1,3,5-trien-1-amine.
| Compound Name | (1Z,3Z)-3-ethenyl-N-methylhexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 89105784 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | (1Z,3Z)-3-ethenyl-N-methylhexa-1,3,5-trien-1-amine |
| SMILES | C=C/C=C(C=C)\C=C/NC |
| InChI | InChI=1S/C9H13N/c1-4-6-9(5-2)7-8-10-3/h4-8,10H,1-2H2,3H3/b8-7-,9-6- |
| InChIKey | UYTBHJSSCCEJIE-QOCNPQIPSA-N |
| XLogP | 2.02 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|