About 2,6-dinitrosobenzaldehyde
2,6-dinitrosobenzaldehyde (PubChem CID 89105952) has the molecular formula C7H4N2O3
and a molecular weight of 164.12 g/mol. Its IUPAC name is 2,6-dinitrosobenzaldehyde.
Molecular Properties
| Compound Name | 2,6-dinitrosobenzaldehyde |
| PubChem CID | 89105952 |
| Molecular Formula | C7H4N2O3 |
| Molecular Weight | 164.12 g/mol |
| Exact Mass | 164.02 |
| IUPAC Name | 2,6-dinitrosobenzaldehyde |
| SMILES | O=Cc1c(N=O)cccc1N=O |
| InChI | InChI=1S/C7H4N2O3/c10-4-5-6(8-11)2-1-3-7(5)9-12/h1-4H |
| InChIKey | ICKPMMDUMGFSPC-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 75.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.12 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dinitrosobenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dinitrosobenzaldehyde?
The IUPAC name of 2,6-dinitrosobenzaldehyde (CID 89105952) is 2,6-dinitrosobenzaldehyde.
What is the SMILES notation for 2,6-dinitrosobenzaldehyde?
The canonical SMILES for 2,6-dinitrosobenzaldehyde is O=Cc1c(N=O)cccc1N=O.
What is the InChIKey of 2,6-dinitrosobenzaldehyde?
The InChIKey is ICKPMMDUMGFSPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4N2O3/c10-4-5-6(8-11)2-1-3-7(5)9-12/h1-4H.
What are the key properties of 2,6-dinitrosobenzaldehyde?
2,6-dinitrosobenzaldehyde has a molecular weight of 164.12 g/mol, XLogP of 2.29, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dinitrosobenzaldehyde is sourced from PubChem (CID 89105952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).