C29H33N4O6PS — CID 89106021
[(Z)-2-amino-3-[3-[[5-(3-cyclopropylsulfinylphenyl)-3-methyl-9H-pyrido[2,3-b]indol-8-yl]oxy]propyl-ethenylamino]prop-2-enyl] dihydrogen phosphate (PubChem CID 89106021) has the molecular formula C29H33N4O6PS and a molecular weight of 596.65 g/mol. Its IUPAC name is [(Z)-2-amino-3-[3-[[5-(3-cyclopropylsulfinylphenyl)-3-methyl-9H-pyrido[2,3-b]indol-8-yl]oxy]propyl-ethenylamino]prop-2-enyl] dihydrogen phosphate.
| Compound Name | [(Z)-2-amino-3-[3-[[5-(3-cyclopropylsulfinylphenyl)-3-methyl-9H-pyrido[2,3-b]indol-8-yl]oxy]propyl-ethenylamino]prop-2-enyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 89106021 |
| Molecular Formula | C29H33N4O6PS |
| Molecular Weight | 596.65 g/mol |
| Exact Mass | 596.19 |
| IUPAC Name | [(Z)-2-amino-3-[3-[[5-(3-cyclopropylsulfinylphenyl)-3-methyl-9H-pyrido[2,3-b]indol-8-yl]oxy]propyl-ethenylamino]prop-2-enyl] dihydrogen phosphate |
| SMILES | C=CN(/C=C(\N)COP(=O)(O)O)CCCOc1ccc(-c2cccc(S(=O)C3CC3)c2)c2c1[nH]c1ncc(C)cc12 |
| InChI | InChI=1S/C29H33N4O6PS/c1-3-33(17-21(30)18-39-40(34,35)36)12-5-13-38-26-11-10-24(20-6-4-7-23(15-20)41(37)22-8-9-22)27-25-14-19(2)16-31-29(25)32-28(26)27/h3-4,6-7,10-11,14-17,22H,1,5,8-9,12-13,18,30H2,2H3,(H,31,32)(H2,34,35,36)/b21-17- |
| InChIKey | FYTAYIPVQHLVGF-FXBPSFAMSA-N |
| XLogP | 5.09 |
| TPSA | 151.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.65 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|