C20H10F9IN2O4S — CID 89106092
N-[2-(difluoromethylsulfonyl)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-iodophenyl]-1-oxidoquinolin-1-ium-7-carboxamide (PubChem CID 89106092) has the molecular formula C20H10F9IN2O4S and a molecular weight of 672.26 g/mol. Its IUPAC name is N-[2-(difluoromethylsulfonyl)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-iodophenyl]-1-oxidoquinolin-1-ium-7-carboxamide.
| Compound Name | N-[2-(difluoromethylsulfonyl)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-iodophenyl]-1-oxidoquinolin-1-ium-7-carboxamide |
|---|---|
| PubChem CID | 89106092 |
| Molecular Formula | C20H10F9IN2O4S |
| Molecular Weight | 672.26 g/mol |
| Exact Mass | 671.93 |
| IUPAC Name | N-[2-(difluoromethylsulfonyl)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-iodophenyl]-1-oxidoquinolin-1-ium-7-carboxamide |
| SMILES | O=C(Nc1c(I)cc(C(F)(C(F)(F)F)C(F)(F)F)cc1S(=O)(=O)C(F)F)c1ccc2ccc[n+]([O-])c2c1 |
| InChI | InChI=1S/C20H10F9IN2O4S/c21-17(22)37(35,36)14-8-11(18(23,19(24,25)26)20(27,28)29)7-12(30)15(14)31-16(33)10-4-3-9-2-1-5-32(34)13(9)6-10/h1-8,17H,(H,31,33) |
| InChIKey | HVLLIKOSOUSQBF-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 90.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.26 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|