C10H5F9INO2S — CID 89106195
2-(difluoromethylsulfonyl)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-iodoaniline (PubChem CID 89106195) has the molecular formula C10H5F9INO2S and a molecular weight of 501.11 g/mol. Its IUPAC name is 2-(difluoromethylsulfonyl)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-iodoaniline.
| Compound Name | 2-(difluoromethylsulfonyl)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-iodoaniline |
|---|---|
| PubChem CID | 89106195 |
| Molecular Formula | C10H5F9INO2S |
| Molecular Weight | 501.11 g/mol |
| Exact Mass | 500.89 |
| IUPAC Name | 2-(difluoromethylsulfonyl)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-iodoaniline |
| SMILES | Nc1c(I)cc(C(F)(C(F)(F)F)C(F)(F)F)cc1S(=O)(=O)C(F)F |
| InChI | InChI=1S/C10H5F9INO2S/c11-7(12)24(22,23)5-2-3(1-4(20)6(5)21)8(13,9(14,15)16)10(17,18)19/h1-2,7H,21H2 |
| InChIKey | OGFLEOGZSGTVMP-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.11 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|