C9H11BrO2 — CID 89106575
5-bromo-1,2-dimethoxy-6-methylidenecyclohexa-1,3-diene (PubChem CID 89106575) has the molecular formula C9H11BrO2 and a molecular weight of 231.09 g/mol. Its IUPAC name is 5-bromo-1,2-dimethoxy-6-methylidenecyclohexa-1,3-diene.
| Compound Name | 5-bromo-1,2-dimethoxy-6-methylidenecyclohexa-1,3-diene |
|---|---|
| PubChem CID | 89106575 |
| Molecular Formula | C9H11BrO2 |
| Molecular Weight | 231.09 g/mol |
| Exact Mass | 229.99 |
| IUPAC Name | 5-bromo-1,2-dimethoxy-6-methylidenecyclohexa-1,3-diene |
| SMILES | C=C1C(OC)=C(OC)C=CC1Br |
| InChI | InChI=1S/C9H11BrO2/c1-6-7(10)4-5-8(11-2)9(6)12-3/h4-5,7H,1H2,2-3H3 |
| InChIKey | AMELWCCTDTWDFA-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.09 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|