About N-(3-acetyl-4-fluorocyclohexa-1,5-dien-1-yl)acetamide
N-(3-acetyl-4-fluorocyclohexa-1,5-dien-1-yl)acetamide (PubChem CID 89107117) has the molecular formula C10H12FNO2
and a molecular weight of 197.21 g/mol. Its IUPAC name is N-(3-acetyl-4-fluorocyclohexa-1,5-dien-1-yl)acetamide.
Molecular Properties
| Compound Name | N-(3-acetyl-4-fluorocyclohexa-1,5-dien-1-yl)acetamide |
| PubChem CID | 89107117 |
| Molecular Formula | C10H12FNO2 |
| Molecular Weight | 197.21 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | N-(3-acetyl-4-fluorocyclohexa-1,5-dien-1-yl)acetamide |
| SMILES | CC(=O)NC1=CC(C(C)=O)C(F)C=C1 |
| InChI | InChI=1S/C10H12FNO2/c1-6(13)9-5-8(12-7(2)14)3-4-10(9)11/h3-5,9-10H,1-2H3,(H,12,14) |
| InChIKey | QWIXZEMEADGERW-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.21 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(3-acetyl-4-fluorocyclohexa-1,5-dien-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-acetyl-4-fluorocyclohexa-1,5-dien-1-yl)acetamide?
The IUPAC name of N-(3-acetyl-4-fluorocyclohexa-1,5-dien-1-yl)acetamide (CID 89107117) is N-(3-acetyl-4-fluorocyclohexa-1,5-dien-1-yl)acetamide.
What is the SMILES notation for N-(3-acetyl-4-fluorocyclohexa-1,5-dien-1-yl)acetamide?
The canonical SMILES for N-(3-acetyl-4-fluorocyclohexa-1,5-dien-1-yl)acetamide is CC(=O)NC1=CC(C(C)=O)C(F)C=C1.
What is the InChIKey of N-(3-acetyl-4-fluorocyclohexa-1,5-dien-1-yl)acetamide?
The InChIKey is QWIXZEMEADGERW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12FNO2/c1-6(13)9-5-8(12-7(2)14)3-4-10(9)11/h3-5,9-10H,1-2H3,(H,12,14).
What are the key properties of N-(3-acetyl-4-fluorocyclohexa-1,5-dien-1-yl)acetamide?
N-(3-acetyl-4-fluorocyclohexa-1,5-dien-1-yl)acetamide has a molecular weight of 197.21 g/mol, XLogP of 1.12, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-acetyl-4-fluorocyclohexa-1,5-dien-1-yl)acetamide is sourced from PubChem (CID 89107117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).