C25H38O5 — CID 89107319
(2S)-2-[(2S,3E,5E,7E,9S,11R)-2,13-dimethoxy-3,9,11-trimethyl-12-oxotrideca-3,5,7-trienyl]-5-methyl-3,4-dihydro-2H-pyran-6-carbaldehyde (PubChem CID 89107319) has the molecular formula C25H38O5 and a molecular weight of 418.57 g/mol. Its IUPAC name is (2S)-2-[(2S,3E,5E,7E,9S,11R)-2,13-dimethoxy-3,9,11-trimethyl-12-oxotrideca-3,5,7-trienyl]-5-methyl-3,4-dihydro-2H-pyran-6-carbaldehyde.
| Compound Name | (2S)-2-[(2S,3E,5E,7E,9S,11R)-2,13-dimethoxy-3,9,11-trimethyl-12-oxotrideca-3,5,7-trienyl]-5-methyl-3,4-dihydro-2H-pyran-6-carbaldehyde |
|---|---|
| PubChem CID | 89107319 |
| Molecular Formula | C25H38O5 |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 418.27 |
| IUPAC Name | (2S)-2-[(2S,3E,5E,7E,9S,11R)-2,13-dimethoxy-3,9,11-trimethyl-12-oxotrideca-3,5,7-trienyl]-5-methyl-3,4-dihydro-2H-pyran-6-carbaldehyde |
| SMILES | COCC(=O)[C@H](C)C[C@H](C)/C=C/C=C/C=C(\C)[C@H](C[C@@H]1CCC(C)=C(C=O)O1)OC |
| InChI | InChI=1S/C25H38O5/c1-18(14-21(4)23(27)17-28-5)10-8-7-9-11-19(2)24(29-6)15-22-13-12-20(3)25(16-26)30-22/h7-11,16,18,21-22,24H,12-15,17H2,1-6H3/b9-7+,10-8+,19-11+/t18-,21-,22+,24+/m1/s1 |
| InChIKey | ZJQGULJOYXKNCR-XUCBNFFZSA-N |
| XLogP | 4.98 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|