C29H18F6O16S4 — CID 89107612
5-[5-[2-[3-(3,5-disulfobenzoyl)-4-hydroxyphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-hydroxybenzoyl]benzene-1,3-disulfonic acid (PubChem CID 89107612) has the molecular formula C29H18F6O16S4 and a molecular weight of 864.70 g/mol. Its IUPAC name is 5-[5-[2-[3-(3,5-disulfobenzoyl)-4-hydroxyphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-hydroxybenzoyl]benzene-1,3-disulfonic acid.
| Compound Name | 5-[5-[2-[3-(3,5-disulfobenzoyl)-4-hydroxyphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-hydroxybenzoyl]benzene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 89107612 |
| Molecular Formula | C29H18F6O16S4 |
| Molecular Weight | 864.70 g/mol |
| Exact Mass | 863.94 |
| IUPAC Name | 5-[5-[2-[3-(3,5-disulfobenzoyl)-4-hydroxyphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-hydroxybenzoyl]benzene-1,3-disulfonic acid |
| SMILES | O=C(c1cc(S(=O)(=O)O)cc(S(=O)(=O)O)c1)c1cc(C(c2ccc(O)c(C(=O)c3cc(S(=O)(=O)O)cc(S(=O)(=O)O)c3)c2)(C(F)(F)F)C(F)(F)F)ccc1O |
| InChI | InChI=1S/C29H18F6O16S4/c30-28(31,32)27(29(33,34)35,15-1-3-23(36)21(9-15)25(38)13-5-17(52(40,41)42)11-18(6-13)53(43,44)45)16-2-4-24(37)22(10-16)26(39)14-7-19(54(46,47)48)12-20(8-14)55(49,50)51/h1-12,36-37H,(H,40,41,42)(H,43,44,45)(H,46,47,48)(H,49,50,51) |
| InChIKey | FWZBOXXLBRZNRG-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 292.08 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 864.70 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|