C29H18F6O10S2 — CID 89107619
3-[5-[1,1,1,3,3,3-hexafluoro-2-[4-hydroxy-3-(3-sulfobenzoyl)phenyl]propan-2-yl]-2-hydroxybenzoyl]benzenesulfonic acid (PubChem CID 89107619) has the molecular formula C29H18F6O10S2 and a molecular weight of 704.58 g/mol. Its IUPAC name is 3-[5-[1,1,1,3,3,3-hexafluoro-2-[4-hydroxy-3-(3-sulfobenzoyl)phenyl]propan-2-yl]-2-hydroxybenzoyl]benzenesulfonic acid.
| Compound Name | 3-[5-[1,1,1,3,3,3-hexafluoro-2-[4-hydroxy-3-(3-sulfobenzoyl)phenyl]propan-2-yl]-2-hydroxybenzoyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 89107619 |
| Molecular Formula | C29H18F6O10S2 |
| Molecular Weight | 704.58 g/mol |
| Exact Mass | 704.02 |
| IUPAC Name | 3-[5-[1,1,1,3,3,3-hexafluoro-2-[4-hydroxy-3-(3-sulfobenzoyl)phenyl]propan-2-yl]-2-hydroxybenzoyl]benzenesulfonic acid |
| SMILES | O=C(c1cccc(S(=O)(=O)O)c1)c1cc(C(c2ccc(O)c(C(=O)c3cccc(S(=O)(=O)O)c3)c2)(C(F)(F)F)C(F)(F)F)ccc1O |
| InChI | InChI=1S/C29H18F6O10S2/c30-28(31,32)27(29(33,34)35,17-7-9-23(36)21(13-17)25(38)15-3-1-5-19(11-15)46(40,41)42)18-8-10-24(37)22(14-18)26(39)16-4-2-6-20(12-16)47(43,44)45/h1-14,36-37H,(H,40,41,42)(H,43,44,45) |
| InChIKey | XGRPZKCHVLATJK-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 183.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.58 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|