C17H26N4S2 — CID 89107636
N'-[7-methyl-4-[2-(methylamino)ethyl]-2,3,6,7-tetrahydro-1,4-benzothiazin-6-yl]-2,3-dihydrothiophene-2-carboximidamide (PubChem CID 89107636) has the molecular formula C17H26N4S2 and a molecular weight of 350.56 g/mol. Its IUPAC name is N'-[7-methyl-4-[2-(methylamino)ethyl]-2,3,6,7-tetrahydro-1,4-benzothiazin-6-yl]-2,3-dihydrothiophene-2-carboximidamide.
| Compound Name | N'-[7-methyl-4-[2-(methylamino)ethyl]-2,3,6,7-tetrahydro-1,4-benzothiazin-6-yl]-2,3-dihydrothiophene-2-carboximidamide |
|---|---|
| PubChem CID | 89107636 |
| Molecular Formula | C17H26N4S2 |
| Molecular Weight | 350.56 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | N'-[7-methyl-4-[2-(methylamino)ethyl]-2,3,6,7-tetrahydro-1,4-benzothiazin-6-yl]-2,3-dihydrothiophene-2-carboximidamide |
| SMILES | CNCCN1CCSC2=CC(C)C(/N=C(\N)C3CC=CS3)C=C21 |
| InChI | InChI=1S/C17H26N4S2/c1-12-10-16-14(21(6-5-19-2)7-9-23-16)11-13(12)20-17(18)15-4-3-8-22-15/h3,8,10-13,15,19H,4-7,9H2,1-2H3,(H2,18,20) |
| InChIKey | MUEIODFDRODEJW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.56 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|