About 3-cyclopropyl-4,5-dimethoxyaniline
3-cyclopropyl-4,5-dimethoxyaniline (PubChem CID 89107680) has the molecular formula C11H15NO2
and a molecular weight of 193.25 g/mol. Its IUPAC name is 3-cyclopropyl-4,5-dimethoxyaniline.
Molecular Properties
| Compound Name | 3-cyclopropyl-4,5-dimethoxyaniline |
| PubChem CID | 89107680 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 3-cyclopropyl-4,5-dimethoxyaniline |
| SMILES | COc1cc(N)cc(C2CC2)c1OC |
| InChI | InChI=1S/C11H15NO2/c1-13-10-6-8(12)5-9(7-3-4-7)11(10)14-2/h5-7H,3-4,12H2,1-2H3 |
| InChIKey | SOXOXPSQLQQBAW-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-cyclopropyl-4,5-dimethoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopropyl-4,5-dimethoxyaniline?
The IUPAC name of 3-cyclopropyl-4,5-dimethoxyaniline (CID 89107680) is 3-cyclopropyl-4,5-dimethoxyaniline.
What is the SMILES notation for 3-cyclopropyl-4,5-dimethoxyaniline?
The canonical SMILES for 3-cyclopropyl-4,5-dimethoxyaniline is COc1cc(N)cc(C2CC2)c1OC.
What is the InChIKey of 3-cyclopropyl-4,5-dimethoxyaniline?
The InChIKey is SOXOXPSQLQQBAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2/c1-13-10-6-8(12)5-9(7-3-4-7)11(10)14-2/h5-7H,3-4,12H2,1-2H3.
What are the key properties of 3-cyclopropyl-4,5-dimethoxyaniline?
3-cyclopropyl-4,5-dimethoxyaniline has a molecular weight of 193.25 g/mol, XLogP of 2.16, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopropyl-4,5-dimethoxyaniline is sourced from PubChem (CID 89107680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).