C27H34N4O2 — CID 89107725
(4-amino-3-methanimidoyl-5-methylphenyl)-[(4Z)-4-butylidene-6,7-dimethylspiro[3H-1,3-benzoxazine-2,4'-piperidine]-1'-yl]methanone (PubChem CID 89107725) has the molecular formula C27H34N4O2 and a molecular weight of 446.60 g/mol. Its IUPAC name is (4-amino-3-methanimidoyl-5-methylphenyl)-[(4Z)-4-butylidene-6,7-dimethylspiro[3H-1,3-benzoxazine-2,4'-piperidine]-1'-yl]methanone.
| Compound Name | (4-amino-3-methanimidoyl-5-methylphenyl)-[(4Z)-4-butylidene-6,7-dimethylspiro[3H-1,3-benzoxazine-2,4'-piperidine]-1'-yl]methanone |
|---|---|
| PubChem CID | 89107725 |
| Molecular Formula | C27H34N4O2 |
| Molecular Weight | 446.60 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | (4-amino-3-methanimidoyl-5-methylphenyl)-[(4Z)-4-butylidene-6,7-dimethylspiro[3H-1,3-benzoxazine-2,4'-piperidine]-1'-yl]methanone |
| SMILES | [H]/N=C/c1cc(C(=O)N2CCC3(CC2)N/C(=C\CCC)c2cc(C)c(C)cc2O3)cc(C)c1N |
| InChI | InChI=1S/C27H34N4O2/c1-5-6-7-23-22-13-17(2)18(3)14-24(22)33-27(30-23)8-10-31(11-9-27)26(32)20-12-19(4)25(29)21(15-20)16-28/h7,12-16,28,30H,5-6,8-11,29H2,1-4H3/b23-7-,28-16+ |
| InChIKey | MTLAQWBXDBRYNA-XYPZFCGSSA-N |
| XLogP | 4.95 |
| TPSA | 91.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.60 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|