C24H30N4O2 — CID 89107762
(4-amino-3-methanimidoyl-5-methylphenyl)-(6-propan-2-ylspiro[3,4-dihydro-1,3-benzoxazine-2,4'-piperidine]-1'-yl)methanone (PubChem CID 89107762) has the molecular formula C24H30N4O2 and a molecular weight of 406.53 g/mol. Its IUPAC name is (4-amino-3-methanimidoyl-5-methylphenyl)-(6-propan-2-ylspiro[3,4-dihydro-1,3-benzoxazine-2,4'-piperidine]-1'-yl)methanone.
| Compound Name | (4-amino-3-methanimidoyl-5-methylphenyl)-(6-propan-2-ylspiro[3,4-dihydro-1,3-benzoxazine-2,4'-piperidine]-1'-yl)methanone |
|---|---|
| PubChem CID | 89107762 |
| Molecular Formula | C24H30N4O2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | (4-amino-3-methanimidoyl-5-methylphenyl)-(6-propan-2-ylspiro[3,4-dihydro-1,3-benzoxazine-2,4'-piperidine]-1'-yl)methanone |
| SMILES | [H]/N=C/c1cc(C(=O)N2CCC3(CC2)NCc2cc(C(C)C)ccc2O3)cc(C)c1N |
| InChI | InChI=1S/C24H30N4O2/c1-15(2)17-4-5-21-20(11-17)14-27-24(30-21)6-8-28(9-7-24)23(29)18-10-16(3)22(26)19(12-18)13-25/h4-5,10-13,15,25,27H,6-9,14,26H2,1-3H3/b25-13+ |
| InChIKey | IIHKHTFZZQENMP-DHRITJCHSA-N |
| XLogP | 3.81 |
| TPSA | 91.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|