C15H20F6O3 — CID 89107803
[3-ethyl-1,1,1-trifluoro-2-hydroxy-2-(trifluoromethyl)pentan-3-yl] cyclohex-3-ene-1-carboxylate (PubChem CID 89107803) has the molecular formula C15H20F6O3 and a molecular weight of 362.31 g/mol. Its IUPAC name is [3-ethyl-1,1,1-trifluoro-2-hydroxy-2-(trifluoromethyl)pentan-3-yl] cyclohex-3-ene-1-carboxylate.
| Compound Name | [3-ethyl-1,1,1-trifluoro-2-hydroxy-2-(trifluoromethyl)pentan-3-yl] cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 89107803 |
| Molecular Formula | C15H20F6O3 |
| Molecular Weight | 362.31 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | [3-ethyl-1,1,1-trifluoro-2-hydroxy-2-(trifluoromethyl)pentan-3-yl] cyclohex-3-ene-1-carboxylate |
| SMILES | CCC(CC)(OC(=O)C1CC=CCC1)C(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H20F6O3/c1-3-12(4-2,13(23,14(16,17)18)15(19,20)21)24-11(22)10-8-6-5-7-9-10/h5-6,10,23H,3-4,7-9H2,1-2H3 |
| InChIKey | KTLRLXFFQRASCB-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.31 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|