C14H18F8O2 — CID 89107813
2,2,3,3,4,4,5,5-octafluoropentyl 2-tert-butyl-3-methylbut-2-enoate (PubChem CID 89107813) has the molecular formula C14H18F8O2 and a molecular weight of 370.28 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5-octafluoropentyl 2-tert-butyl-3-methylbut-2-enoate.
| Compound Name | 2,2,3,3,4,4,5,5-octafluoropentyl 2-tert-butyl-3-methylbut-2-enoate |
|---|---|
| PubChem CID | 89107813 |
| Molecular Formula | C14H18F8O2 |
| Molecular Weight | 370.28 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 2,2,3,3,4,4,5,5-octafluoropentyl 2-tert-butyl-3-methylbut-2-enoate |
| SMILES | CC(C)=C(C(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F)C(C)(C)C |
| InChI | InChI=1S/C14H18F8O2/c1-7(2)8(11(3,4)5)9(23)24-6-12(17,18)14(21,22)13(19,20)10(15)16/h10H,6H2,1-5H3 |
| InChIKey | XDNQYVLYXLQAIX-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.28 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|