C34H27N3O10S — CID 89108315
benzhydryl (2S,5R,6Z)-3-methyl-3-[(4-nitrophenoxy)carbonyloxymethyl]-4,4,7-trioxo-6-(pyridin-2-ylmethylidene)-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 89108315) has the molecular formula C34H27N3O10S and a molecular weight of 669.67 g/mol. Its IUPAC name is benzhydryl (2S,5R,6Z)-3-methyl-3-[(4-nitrophenoxy)carbonyloxymethyl]-4,4,7-trioxo-6-(pyridin-2-ylmethylidene)-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | benzhydryl (2S,5R,6Z)-3-methyl-3-[(4-nitrophenoxy)carbonyloxymethyl]-4,4,7-trioxo-6-(pyridin-2-ylmethylidene)-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 89108315 |
| Molecular Formula | C34H27N3O10S |
| Molecular Weight | 669.67 g/mol |
| Exact Mass | 669.14 |
| IUPAC Name | benzhydryl (2S,5R,6Z)-3-methyl-3-[(4-nitrophenoxy)carbonyloxymethyl]-4,4,7-trioxo-6-(pyridin-2-ylmethylidene)-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CC1(COC(=O)Oc2ccc([N+](=O)[O-])cc2)[C@H](C(=O)OC(c2ccccc2)c2ccccc2)N2C(=O)/C(=C/c3ccccn3)[C@H]2S1(=O)=O |
| InChI | InChI=1S/C34H27N3O10S/c1-34(21-45-33(40)46-26-17-15-25(16-18-26)37(41)42)29(32(39)47-28(22-10-4-2-5-11-22)23-12-6-3-7-13-23)36-30(38)27(31(36)48(34,43)44)20-24-14-8-9-19-35-24/h2-20,28-29,31H,21H2,1H3/b27-20-/t29-,31+,34?/m0/s1 |
| InChIKey | QKJLWBVFUFIOCR-NXUFLTDRSA-N |
| XLogP | 4.65 |
| TPSA | 172.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.67 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|