C11H12O5 — CID 89108322
methyl (4S,8S,12S)-3,5,11-trioxatetracyclo[6.3.1.01,10.04,12]dodec-6-ene-7-carboxylate (PubChem CID 89108322) has the molecular formula C11H12O5 and a molecular weight of 224.21 g/mol. Its IUPAC name is methyl (4S,8S,12S)-3,5,11-trioxatetracyclo[6.3.1.01,10.04,12]dodec-6-ene-7-carboxylate.
| Compound Name | methyl (4S,8S,12S)-3,5,11-trioxatetracyclo[6.3.1.01,10.04,12]dodec-6-ene-7-carboxylate |
|---|---|
| PubChem CID | 89108322 |
| Molecular Formula | C11H12O5 |
| Molecular Weight | 224.21 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | methyl (4S,8S,12S)-3,5,11-trioxatetracyclo[6.3.1.01,10.04,12]dodec-6-ene-7-carboxylate |
| SMILES | COC(=O)C1=CO[C@@H]2OCC34OC3C[C@H]1[C@H]24 |
| InChI | InChI=1S/C11H12O5/c1-13-9(12)6-3-14-10-8-5(6)2-7-11(8,16-7)4-15-10/h3,5,7-8,10H,2,4H2,1H3/t5-,7?,8-,10-,11?/m1/s1 |
| InChIKey | SUJXYZGQRBLIGP-AXZJERFZSA-N |
| XLogP | 0.20 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.21 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|