About methyl 2-(2-bicyclo[2.2.1]hepta-1(7),5-dienyl)acetate
methyl 2-(2-bicyclo[2.2.1]hepta-1(7),5-dienyl)acetate (PubChem CID 89108364) has the molecular formula C10H12O2
and a molecular weight of 164.20 g/mol. Its IUPAC name is methyl 2-(2-bicyclo[2.2.1]hepta-1(7),5-dienyl)acetate.
Molecular Properties
| Compound Name | methyl 2-(2-bicyclo[2.2.1]hepta-1(7),5-dienyl)acetate |
| PubChem CID | 89108364 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | methyl 2-(2-bicyclo[2.2.1]hepta-1(7),5-dienyl)acetate |
| SMILES | COC(=O)CC1CC2C=CC1=C2 |
| InChI | InChI=1S/C10H12O2/c1-12-10(11)6-9-5-7-2-3-8(9)4-7/h2-4,7,9H,5-6H2,1H3 |
| InChIKey | WQPULTYFJHNXGF-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methyl 2-(2-bicyclo[2.2.1]hepta-1(7),5-dienyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(2-bicyclo[2.2.1]hepta-1(7),5-dienyl)acetate?
The IUPAC name of methyl 2-(2-bicyclo[2.2.1]hepta-1(7),5-dienyl)acetate (CID 89108364) is methyl 2-(2-bicyclo[2.2.1]hepta-1(7),5-dienyl)acetate.
What is the SMILES notation for methyl 2-(2-bicyclo[2.2.1]hepta-1(7),5-dienyl)acetate?
The canonical SMILES for methyl 2-(2-bicyclo[2.2.1]hepta-1(7),5-dienyl)acetate is COC(=O)CC1CC2C=CC1=C2.
What is the InChIKey of methyl 2-(2-bicyclo[2.2.1]hepta-1(7),5-dienyl)acetate?
The InChIKey is WQPULTYFJHNXGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O2/c1-12-10(11)6-9-5-7-2-3-8(9)4-7/h2-4,7,9H,5-6H2,1H3.
What are the key properties of methyl 2-(2-bicyclo[2.2.1]hepta-1(7),5-dienyl)acetate?
methyl 2-(2-bicyclo[2.2.1]hepta-1(7),5-dienyl)acetate has a molecular weight of 164.20 g/mol, XLogP of 1.68, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(2-bicyclo[2.2.1]hepta-1(7),5-dienyl)acetate is sourced from PubChem (CID 89108364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).