C24H26F4NO4+ — CID 89108400
[(4R,7R)-4-[2,2-bis(3,5-difluorophenyl)-2-hydroxyacetyl]oxy-8-oxabicyclo[5.1.0]octan-2-yl]-trimethylazanium (PubChem CID 89108400) has the molecular formula C24H26F4NO4+ and a molecular weight of 468.47 g/mol. Its IUPAC name is [(4R,7R)-4-[2,2-bis(3,5-difluorophenyl)-2-hydroxyacetyl]oxy-8-oxabicyclo[5.1.0]octan-2-yl]-trimethylazanium.
| Compound Name | [(4R,7R)-4-[2,2-bis(3,5-difluorophenyl)-2-hydroxyacetyl]oxy-8-oxabicyclo[5.1.0]octan-2-yl]-trimethylazanium |
|---|---|
| PubChem CID | 89108400 |
| Molecular Formula | C24H26F4NO4+ |
| Molecular Weight | 468.47 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | [(4R,7R)-4-[2,2-bis(3,5-difluorophenyl)-2-hydroxyacetyl]oxy-8-oxabicyclo[5.1.0]octan-2-yl]-trimethylazanium |
| SMILES | C[N+](C)(C)C1C[C@H](OC(=O)C(O)(c2cc(F)cc(F)c2)c2cc(F)cc(F)c2)CC[C@H]2OC12 |
| InChI | InChI=1S/C24H26F4NO4/c1-29(2,3)20-12-19(4-5-21-22(20)33-21)32-23(30)24(31,13-6-15(25)10-16(26)7-13)14-8-17(27)11-18(28)9-14/h6-11,19-22,31H,4-5,12H2,1-3H3/q+1/t19-,20?,21-,22?/m1/s1 |
| InChIKey | MKLXQHGZCVWHBO-BJTVZRGDSA-N |
| XLogP | 3.42 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.47 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|